| Identification | |
| Name: | 2H-1-Benzopyran-3,5,7-triol,2-(3,4-dihydroxyphenyl)-3,4-dihydro-, (2R,3R)- |
| Synonyms: | 2H-1-Benzopyran-3,5,7-triol,2-(3,4-dihydroxyphenyl)-3,4-dihydro-, (2R-cis)-; Epicatechol, (-)- (8CI);(-)-(2R:3R)-5,7,3',4'-Tetrahydroxyflavan-3-ol; (-)-Epicatechin;(-)-Epicatechol; (2R,3R)-(-)-Epicatechin; Epicatechin; Epicatechol;L-Epicatechin; NSC 81161; epi-Catechin; epi-Catechol; l-Acacatechin;l-Epicatechin; l-Epicatechol |
| CAS: | 490-46-0 |
| EINECS: | 207-710-1 |
| Molecular Formula: | C15H14 O6 |
| Molecular Weight: | 290.27 |
| InChI: | InChI=1/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.593g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | White to light yellow crystal powder |
| Specification: |
L-Epicatechin (CAS NO.490-46-0) also can be called 2-(3,4-Dihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol ; and (2R,3R)-2-(3,4-Dihydroxyphenyl)-3,5,7-chromanetriol . |
| Usage: | Antioxidant. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
