| Identification |
| Name: | Cyclohexanone,5-methyl-2-(1-methylethyl)-, (2R,5R)-rel- |
| CAS: | 491-07-6 |
| EINECS: | 207-727-4 |
| Molecular Formula: | C10H18 O |
| Molecular Weight: | 154.28 |
| InChI: | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3/t8-,9-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.881g/cm3 |
| Solubility: | Sol in alc, fixed oils; very slightly sol in water. SOL IN MOST COMMON ORG SOLVENTS In water, 688 mg/l @ 25 deg C |
| Specification: | Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Color: | Colorless, oily, mobile liq |
| Safety Data |
| |
 |