| Identification |
| Name: | Lepidine |
| Synonyms: | 4-Methylquinoline; 4-Methylchinoline; Lepidine,(4-Methylquinoline); 4-Methyl quinoline |
| CAS: | 491-35-0 |
| EINECS: | 207-734-2 |
| Molecular Formula: | C10H9N |
| Molecular Weight: | 143.19 |
| InChI: | InChI=1/C10H9N/c1-8-6-7-11-10-5-3-2-4-9(8)10/h2-7H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 61848 |
| Density: | 1.083 |
| Stability: | Stable under normal temperatures and pressures. Turns reddish-brown on exposure to light. |
| Refractive index: | 1.618-1.62 |
| Water Solubility: | Slightly soluble |
| Solubility: | Slightly soluble in water |
| Appearance: | Colorless or yellow liquid |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Color: | Colorless, oily liquid |
| Usage: | Used in the preparation of certain dyes. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
