| Identification | |
| Name: | 4H-1-Benzopyran-4-one,2,3-dihydro- |
| Synonyms: | 4-Chromanone(6CI,7CI,8CI);2,3-Dihydro-4-benzopyranone;2,3-Dihydro-4H-1-benzopyran-4-one;2,3-Dihydro-4H-chromen-4-one;Chromanone;NSC 174058; |
| CAS: | 491-37-2 |
| EINECS: | 207-736-3 |
| Molecular Formula: | C9H8O2 |
| Molecular Weight: | 148.16 |
| InChI: | InChI=1/C9H8O2/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-4H,5-6H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.196 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.575 |
| Solubility: | Slightly soluble |
| Appearance: | white to light yellow crystal powder |
| Specification: | white to light yellow crystal powder Safety Statements:24/25-36-26 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
