| Identification | |
| Name: | 9-Thioxanthen-9-one |
| Synonyms: | Thioxanthone; 9H-thioxanthen-9-one; Prothiene; 9H-Thioxanthene, 9-oxo-; Thiaxanthenone; Thiaxanthon; Thiaxanthone; Thioxanthene, 9-oxo-; Thioxanthene-9-one; Thioxanthenone; THIOXANTHEN-9-ONE |
| CAS: | 492-22-8 |
| EINECS: | 207-749-4 |
| Molecular Formula: | C13H8OS |
| Molecular Weight: | 212.27 |
| InChI: | InChI=1/C13H8OS/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.309g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.692 |
| Water Solubility: | practically insoluble |
| Solubility: | practicallyinsoluble |
| Appearance: | slightly yellow crystalline powder |
| Specification: |
Thioxanthone , its CAS NO. is 492-22-8, the synonyms are 10-Thioxanthone ; 9-Thioxanthone ; 9H-Thioxanthene, 9-oxo- ; EINECS 207-749-4 ; NSC 658181 ; Thiaxanthenone ; Thioxanthene, 9-oxo- ; Thioxanthene-9-one . |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Chain transfer agent in the free radical polymerization of methylmethacrylate and styrene. |
| Safety Data | |
 |
|
