| Identification |
| Name: | 2-Quinolinecarboxylicacid, 4-hydroxy- |
| Synonyms: | Quinaldicacid, 4-hydroxy- (8CI);2-Carboxy-4-hydroxyquinoline;4-Hydroxyquinaldic acid;4-Hydroxyquinaldinic acid;4-Hydroxyquinoline-2-carboxylic acid;Kynurenicacid;NSC 58973;Quinurenic acid; |
| CAS: | 492-27-3 |
| EINECS: | 207-751-5 |
| Molecular Formula: | C10H7NO3 |
| Molecular Weight: | 189.16748 |
| InChI: | InChI=1S/C10H7NO3/c12-9-5-8(10(13)14)11-7-4-2-1-3-6(7)9/h1-5H,(H,11,12)(H,13,14) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.429 g/cm3 |
| Appearance: | Off-white to tan powder. |
| Biological Activity: | Broad spectrum EAA antagonist. |
| Storage Temperature: | Store at RT |
| Usage: | A product of L-Tryptophan metabolism, possessing neruoactive activity having antiexcitotoxic and anticonvulsant properties. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
