| Identification | |
| Name: | Benzeneacetic acid, a-methyl- |
| Synonyms: | Hydratropicacid (6CI,7CI,8CI);(RS)-2-Phenylpropanoic acid;Hydratropic acid;2-Phenylpropanoic acid;2-Phenylpropionic acid;NSC 245033;NSC 42872;dl-PPA;a-Methylbenzeneacetic acid;a-Methylphenylacetic acid;a-Phenylpropanoic acid;2328-24-7; |
| CAS: | 492-37-5 |
| EINECS: | 207-752-0 |
| Molecular Formula: | C9H10O2 |
| Molecular Weight: | 150.18 |
| InChI: | InChI=1/C9H10O2/c1-7(9(10)11)8-5-3-2-4-6-8/h2-7H,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.1 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5215-1.5235 |
| Solubility: | 10 g/L (20 oC) in water |
| Appearance: | Clourless liquid |
| Specification: | clear pale yellow to yellow liquid Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| HS Code: | 29163900 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
