| Identification | |
| Name: | alpha-Furil |
| Synonyms: | 2,2-Furil, 98%; 1,2-Di(2-furyl)ethane-1,2-dione |
| CAS: | 492-94-4 |
| EINECS: | 207-766-7 |
| Molecular Formula: | C10H6O4 |
| Molecular Weight: | 190.15 |
| InChI: | InChI=1/C10H6O4/c11-9(7-3-1-5-13-7)10(12)8-4-2-6-14-8/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 138.4ºC |
| Boiling Point: | 302.7 ºC at 760 mmHg |
| Density: | 1.302 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.54 |
| Water Solubility: | Slight solubility in water |
| Solubility: | Slight solubility in water |
| Appearance: | White crystal or powder. Odorless. |
| Specification: | YELLOW-BROWN CRYSTALLINE POWDER Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 138.4ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry area away from incompatible substances. |
| Safety Data | |
 |
|
