| Identification |
| Name: | 3-Methyl-2-nitrophenol |
| Synonyms: | Nitrocresol; 98%; 2-Nitro-m-cresol; 2-Nitro-3-methylphenol |
| CAS: | 4920-77-8 |
| EINECS: | 225-546-9 |
| Molecular Formula: | C7H7NO3 |
| Molecular Weight: | 153.14 |
| InChI: | InChI=1/C7H7NO3/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4,9H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2446 |
| Density: | 1.32 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | slightly soluble in Water |
| Solubility: | slightly soluble in Water |
| Appearance: | yellow to orange-brown crystalline powder or low melting mass |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
