Identification |
Name: | 1H-1,2,4-Triazole-3-carboxylic acid |
Synonyms: | 1,2,4-Triazole-3-carboxylic acid;4H-1,2,4-Triazole-3-carboxylic acid;NSC165527;NSC 202574; |
CAS: | 4928-87-4 |
Molecular Formula: | C3H3N3O2 |
Molecular Weight: | 113.07 |
InChI: | InChI=1/C3H3N3O2/c7-3(8)2-4-1-5-6-2/h1H,(H,7,8)(H,4,5,6)/p-1 |
Molecular Structure: |
|
Properties |
Density: | 1.694 g/cm3 |
Appearance: | Yellowish crystalline powder |
Specification: |
1H-1,2,4-Triazole-3-carboxylic acid , its cas register number is 4928-87-4. It also can be called 1H-1,2,4-triazole-5-carboxylic acid ; and 4H-1,2,4-Triazole-3-carboxylic acid .
|
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
|