| Identification | |
| Name: | 1,4-Benzodioxin,2,3-dihydro- |
| Synonyms: | 1,4-Benzodioxan(6CI,7CI,8CI);1,2-(Ethylenedioxy)benzene;2,3-Dihydro-1,4-benzodioxin;2,3-Dihydrobenzo[1,4]dioxine;Benzene, 1,2-[1,2-ethanediylbis(oxy)]-;Ethyleneo-phenylene dioxide;NSC 406705;Pyrocatechol ethylene ether; |
| CAS: | 493-09-4 |
| EINECS: | 207-775-6 |
| Molecular Formula: | C8H8O2 |
| Molecular Weight: | 136.15 |
| InChI: | InChI=1/C8H8O2/c1-2-4-8-7(3-1)9-5-6-10-8/h1-4H,5-6H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.142 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5485-1.5505 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Clear, colorless liquid. |
| Specification: | CLEAR COLOURLESS TO VERY SLIGHTLY YELLOW LIQUID Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
| HS Code: | 29329995 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
