| Identification | |
| Name: | Acetic acid,2-(2,4,5-trichlorophenoxy)-, 2-methylpropyl ester |
| Synonyms: | Aceticacid, (2,4,5-trichlorophenoxy)-, 2-methylpropyl ester (9CI); Acetic acid,(2,4,5-trichlorophenoxy)-, isobutyl ester (6CI,7CI,8CI);2,4,5-Trichlorophenoxyacetic acid isobutyl ester; Isobutyl 2,4,5-T |
| CAS: | 4938-72-1 |
| EINECS: | 225-580-4 |
| Molecular Formula: | C12H13 Cl3 O3 |
| Molecular Weight: | 311.5888 |
| InChI: | InChI=1/C12H13Cl3O3/c1-7(2)5-18-12(16)6-17-11-4-9(14)8(13)3-10(11)15/h3-4,7H,5-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3077 9/PG 3 |
| Density: | 1.322 g/cm3 |
| Stability: | Stable. Hydrolyzes under acidic conditions. Keep cool. |
| Refractive index: | 1.527 |
| Appearance: | off-white solid |
| Specification: | off-white solid Safety Statements:24-60-61 24:Avoid contact with skin 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Safety Data | |
 |
|
