| Identification | |
| Name: | 1-Butanone, 1-phenyl- |
| Synonyms: | Butyrophenone(6CI,8CI);1-Benzoylpropane;1-Phenyl-1-butanone;Butanophenone;NSC 8463;Phenyl n-propyl ketone;Phenyl propyl ketone;Propyl phenyl ketone;n-Butyrophenone;n-Propyl phenyl ketone; |
| CAS: | 495-40-9 |
| EINECS: | 207-799-7 |
| Molecular Formula: | C10H12O |
| Molecular Weight: | 148.2 |
| InChI: | InChI=1/C10H12O/c1-2-6-10(11)9-7-4-3-5-8-9/h3-5,7-8H,2,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.988 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.5185-1.5205 |
| Solubility: | Insoluble |
| Appearance: | colourless to yellow liquid |
| Specification: | colourless to yellow liquid usageEng:Intermediates of Liquid Crystals Safety Statements:26-36/37/39-24/25-23 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 24/25:Avoid contact with skin and eyes 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) |
| HS Code: | 29143900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
