| Identification | |
| Name: | D-Mannose, 2,5-anhydro- |
| Synonyms: | Mannose,2,5-anhydro-, D- (6CI,8CI); 2,5-Anhydro-D-mannose; 2,5-Anhydromannose; Chitose;D-2,5-Anhydromannose |
| CAS: | 495-75-0 |
| Molecular Formula: | C6H10 O5 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H10O5/c7-1-3-5(9)6(10)4(2-8)11-3/h1,3-6,8-10H,2H2/t3-,4-,5-,6-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 175.985°C |
| Boiling Point: | 404.697°C at 760 mmHg |
| Density: | 1.64g/cm3 |
| Stability: | Very Hygroscopic |
| Refractive index: | 1.65 |
| Specification: | Yellow to Orange Solid usageEng:This compound is a mixture of the acetal and aldehyde forms. |
| Flash Point: | 175.985°C |
| Usage: | This compound is a mixture of the acetal and aldehyde forms. |
| Safety Data | |
 |
|
