| Identification | |
| Name: | Piperonyl alcohol |
| Synonyms: | Piperonylalcohol (6CI,7CI,8CI);(Benzodioxol-5-yl)methanol;1-Hydroxymethyl-3,4-methylenedioxybenzene;3,4-(Methylenedioxy)benzenemethanol;3,4-Methylenedioxybenzyl alcohol;3,4-Methylenedioxyphenylmethanol;5-Hydroxymethyl-1,3-benzodioxole;Benzo[1,3]dioxol-5-ylmethanol;1,3-Benzodioxole-5-methanol;NSC26265;Piperonol; |
| CAS: | 495-76-1 |
| EINECS: | 207-808-4 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.15 |
| InChI: | InChI=1/C8H8O3/c9-4-6-1-2-7-8(3-6)11-5-10-7/h1-3,9H,4-5H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 124.5°C |
| Boiling Point: | 112 °C |
| Density: | 1.329g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.594 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | White powder. |
| Specification: | WHITE CRYSTALS OR CRYSTALLINE POWDER Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| HS Code: | 29329970 |
| Flash Point: | 124.5°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
