| Identification | |
| Name: | Benzoic acid,2-(acetylamino)-5-fluoro- |
| Synonyms: | 2-Acetamido-5-fluorobenzoicacid;N-Acetyl-5-fluoroanthranilic acid; |
| CAS: | 49579-56-8 |
| Molecular Formula: | C9H8FNO3 |
| Molecular Weight: | 197.16 |
| InChI: | InChI=1/C9H8FNO3/c1-5(12)11-8-3-2-6(10)4-7(8)9(13)14/h2-4H,1H3,(H,11,12)(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.415 g/cm3 |
| Refractive index: | 1.597 |
| Specification: |
The 2-Acetamido-5-fluorobenzoic acid ,its cas register number is 49579-56-8.The Systematic name about this chemicals is 2-(Acetylamino)-5-fluorobenzoic acid .Following are the physical and chemical properties about it: (1)#H bond acceptors: 4 (2)#H bond donors: 2 (3)#Freely Rotating Bonds: 2 (4)Index of Refraction: 1.597 (5)Molar Refractivity: 47.44 cm3 (6)Molar Volume: 139.2 cm3 (7)Surface Tension: 55.6 dyne/cm (8)Enthalpy of Vaporization: 70.28 kJ/mol (9)Vapour Pressure: 1.38E-07 mmHg at 25°C . The 2-Acetamido-5-fluorobenzoic acid is a irriant chemicals, the hazard note also is Irritant. This chemicals can be described computed from structure: |
| Safety Data | |
 |
|
