| Identification | |
| Name: | 1H-Indene, 2,3-dihydro- |
| Synonyms: | Indan(8CI);1,2-Hydrindene;2,3-Dihydro-1H-indene;2,3-Dihydroindene;Benzocyclopentane;Hydrindene;Hydrindonaphthene;Indane;NSC 5292; |
| CAS: | 496-11-7 |
| EINECS: | 207-814-7 |
| Molecular Formula: | C9H10 |
| Molecular Weight: | 118.1757 |
| InChI: | InChI=1S/C9H10/c1-2-5-9-7-3-6-8(9)4-1/h1-2,4-5H,3,6-7H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3295 3/PG 3 |
| Melting Point: | −51 °C(lit.) |
| Flash Point: | 50°C |
| Boiling Point: | 176 °C(lit.) |
| Density: | 0.997g/cm3 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.537(lit.) |
| Water Solubility: | Stability Stable. Flammable. Incompatible with strong oxidizing agents. Toxicology Harmful - may cause lung damage if swallowed. Toxicity data (The meaning of an |
| Solubility: |
|
| Appearance: | colourless to faintly yellow liquid |
| Specification: | colourless to faintly yellow liquid Safety Statements:23-24/25-62 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes 62:If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label |
| Packinggroup: | III |
| Flash Point: | 50°C |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols | |
 |
|
