| Identification |
| Name: | Phthalan |
| Synonyms: | Phthalan(6CI,7CI,8CI);1,3-Dihydroisobenzofuran;2-Oxaindan;Isocoumaran; |
| CAS: | 496-14-0 |
| EINECS: | 207-815-2 |
| Molecular Formula: | C8H8O |
| Molecular Weight: | 120.15 |
| InChI: | InChI=1/C8H8O/c1-2-4-8-6-9-5-7(8)3-1/h1-4H,5-6H2 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 6 |
| Density: | 1.098 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.545-1.547 |
| Appearance: | Clear yellow liquid. |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
