| Identification | |
| Name: | Benzofuran-2-carboxylic acid |
| Synonyms: | Coumarilicacid (6CI);1-Benzofuran-2-carboxylic acid;2,3-Benzofuran-2-carboxylic acid;2-Carboxybenzofuran;Benzo[b]furan-2-carboxylic acid;Coumarone-2-carboxylicacid;NSC 6165;2-Benzofurancarboxylicacid; |
| CAS: | 496-41-3 |
| EINECS: | 207-818-9 |
| Molecular Formula: | C9H6O3 |
| Molecular Weight: | 162.14 |
| InChI: | InChI=1/C9H6O3/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 143.3°C |
| Boiling Point: | 310-315°C |
| Density: | g/cm3 |
| Refractive index: | 1.649 |
| Water Solubility: | partially soluble |
| Solubility: | partially soluble |
| Appearance: | white to light yellow crystal powder |
| Specification: | white to light yellow crystal powde Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29329985 |
| Flash Point: | 143.3°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
