| Identification | |
| Name: | 4-Hydroxy-3-methoxybenzyl alcohol |
| Synonyms: | Vanillyl alcohol |
| CAS: | 498-00-0 |
| EINECS: | 207-852-4 |
| Molecular Formula: | C8H10O3 |
| Molecular Weight: | 154.16 |
| InChI: | InChI=1/C8H10O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-4,9-10H,5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 143.2ºC |
| Boiling Point: | 313.1 ºC at 760 mmHg |
| Density: | 1.226 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids. |
| Refractive index: | 1.57 |
| Solubility: | Soluble |
| Appearance: | crystalline white to off-white powder |
| Specification: |
4-Hydroxy-3-methoxybenzyl alcohol , its cas register number is 498-00-0. It also can be called 4-Hydroxy-3-methoxybenzenemethanol ; 4-Hydroxy-3-methoxybenzyl alcohol ; 4-Hydroxy-3-methoxyphenylmethanol ; AI3-24186 ; Benzenemethanol, 4-hydroxy-3-methoxy- ; Vanillic alcohol ; Vanillin alcohol ; Vanillyl alcohol . 4-Hydroxy-3-methoxybenzyl alcohol (CAS NO.498-00-0) is crystalline white to off-white powder . |
| HS Code: | 29095090 |
| Flash Point: | 143.2ºC |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Usage: | Food flavoring. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
