| Identification | |
| Name: | Butanedioic acid,2-methyl- |
| Synonyms: | Butanedioicacid, methyl- (9CI);Pyrotartaric acid (6CI);Succinic acid, methyl- (8CI);1,2-Propanedicarboxylic acid;2-Methylbutane-1,4-dioic acid;2-Methylbutanedioic acid;DL-Methylbutanedioic acid;DL-Methylsuccinic acid;DL-a-Methylsuccinic acid;Methylbutanedioic acid;Methylsuccinic acid;NSC 5276;R,S-2-Methylbutanedioicacid; |
| CAS: | 498-21-5 |
| EINECS: | 207-857-1 |
| Molecular Formula: | C5H8O4 |
| Molecular Weight: | 132.11 |
| InChI: | InChI=1/C5H8O4/c1-3(5(8)9)2-4(6)7/h3H,2H2,1H3,(H,6,7)(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 111 |
| Boiling Point: | decomposes |
| Density: | 1.4105 g/cm3 |
| Stability: | Stable. Combustible. Incompatible with bases, oxidizing agents, reducing agents. |
| Refractive index: | 1.474 |
| Water Solubility: | moderate Stability Stable. Combustible. Incompatible with bases, oxidizing agents, reducing agents. Toxicology Skin, eye and respiratory irritant. Toxicity data |
| Solubility: | moderate
|
| Appearance: | white to beige crystalline powder |
| Specification: |
2-Methylsuccinic acid , its CAS NO. is 498-21-5, the synonyms are 1,2-Propanedicarboxylic acid ; Butanedioic acid, methyl- ; CCRIS 6068 ; Methylsuccinic acid ; NSC 5276 ; Pyrotartaric acid ; Succinic acid, methyl- (8CI) . |
| Flash Point: | 111 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
