| Identification | |
| Name: | 4-Chloro-2-(methylthio)pyrimidine |
| Synonyms: | 4-Chloro-2-(methylmercapto)pyrimidine; 4-Chloro-2-methylthiopyrimidine |
| CAS: | 49844-90-8 |
| EINECS: | 256-500-6 |
| Molecular Formula: | C5H5ClN2S |
| Molecular Weight: | 160.62 |
| InChI: | InChI=1/C5H5ClN2S/c1-9-5-7-3-2-4(6)8-5/h2-3H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1760 |
| Density: | 1.381 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.600 |
| Solubility: | Slightly soluble |
| Appearance: | colorless liquid |
| Specification: |
4-Chloro-2-methylthiopyrimidine , with CAS number of 49844-90-8, can be called pyrimidine, 4-chloro-2-(methylthio)- ; 2-Methylthio-4-Chloro-Methoxypyrimidine ; 4-Chloro-2-(methylthio)pyrimidine 97% ; 4-Chloro-2-Methylthiopyrimidine4-Chloro-2-(Methylsulfanyl)pyrimidine . It is a clear yellow to brown liquid. |
| Packinggroup: | III |
| Storage Temperature: | Corrosives area. |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
