| Identification | |
| Name: | 2,4-Dichloro-5-nitropyrimidine |
| Synonyms: | 2,4-dichloro-5-nitro-pyrimidine; |
| CAS: | 49845-33-2 |
| Molecular Formula: | C4HCl2N3O2 |
| Molecular Weight: | 193.98 |
| InChI: | InChI=1/C4HCl2N3O2/c5-3-2(9(10)11)1-7-4(6)8-3/h1H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.737 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.611 |
| Solubility: | 1.0 g/L (25 C) |
| Appearance: | Yellow Solid |
| Specification: |
?2,4-dichloro-5-nitropyrimidine (49845-33-2) is?yellow solid with?some synonyms such as?2,4-DICHLORO-5-NITROPYRIMIDINE ; 2,4-DICHLORO-5-NITROPYRIMIDINE 97% ; Pyrimidine, 2,4-dichloro-5-nitro- ; 2,4-Dichloro-5-nitropyrimidine ,97% . According to its structre, it is a?pyrimidine compoud used in?pharmacetical industry.?Make sure?keep this product under argon?and keep container tightly closed. |
| Storage Temperature: | Keep under Argon |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
