| Identification | |
| Name: | Benzoic acid,4-hydroxy-3-methyl- |
| Synonyms: | 4,3-Cresoticacid (8CI);3-Methyl-4-hydroxybenzoic acid; |
| CAS: | 499-76-3 |
| EINECS: | 207-890-1 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.14 |
| InChI: | InChI=1/C8H8O3/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4,9H,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 173-177 °C |
| Flash Point: | 168.4°C |
| Boiling Point: | 331.3°Cat760mmHg |
| Density: | 1.304g/cm3 |
| Refractive index: | 1.599 |
| Specification: | Safety Statements:26-36/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/39:Wear suitable protective clothing and eye/face protection 36:Wear suitable protective clothing |
| Flash Point: | 168.4°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
 |
|
