| Identification | |
| Name: | Benzo(a)pyrene |
| Synonyms: | 3,4-Benz[a]pyrene;3,4-Benzopyrene;3,4-Benzpyrene;3,4-Benzpyrene (carcinogen);4,5-Benzpyrene;6,7-Benzopyrene;BaP;Benz[a]pyrene;Benzo[d,e,f]chrysene;Benzopyrene;NSC21914; |
| CAS: | 50-32-8 |
| EINECS: | 200-028-5 |
| Molecular Formula: | C20H12 |
| Molecular Weight: | 252.3093 |
| InChI: | InChI=1S/C20H12/c1-2-7-17-15(4-1)12-16-9-8-13-5-3-6-14-10-11-18(17)20(16)19(13)14/h1-12H |
| Molecular Structure: | ![(C20H12) 3,4-Benz[a]pyrene;3,4-Benzopyrene;3,4-Benzpyrene;3,4-Benzpyrene (carcinogen);4,5-Benzpyrene;6,7-Benz...](https://img1.guidechem.com/structure/image/50-32-8.jpg) |
| Properties | |
| Transport: | UN 1145 |
| Density: | 1.286 g/cm3/sup> |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Insoluble. 0.00000038 g/100 mL |
| Solubility: | 1.60x10-3 mg/l @oC in water |
| Appearance: | yellow to brown powder. |
| Specification: | yellow crystals or powder [found in cigarette smoke, Safety Statements:45-53-61-60-26-62 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 53:Avoid exposure - obtain special instruction before use 61:Avoid release to the environment. Refer to special instructions safety data sheet 60:This material and/or its container must be disposed of as hazardous waste 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 62:If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label |
| Packinggroup: | III |
| Storage Temperature: | APPROX 4°C |
| Color: | PALE YELLOW MONOCLINIC NEEDLES FROM BENZENE & METHANOL Yellowish plates, needles from benzene + methanol; crystals may be monoclinic or orthorhombic. Yellowish plates (from benzene and ligroin) |
| Safety Data | |
| Hazard Symbols |
F:Flammable
T:Toxic
|
 |
|
