| Identification | ||
| Name: | thalidomide | |
| Synonyms: | 2-phthalimidoglutarimide; 2-(2,6-dioxo-3-piperidinyl)-1h-isoindole-1,3(2h)-dione | |
| CAS: | 50-35-1 | |
| EINECS: | 200-031-1 | |
| Molecular Formula: | C13H10N2O4 | |
| Molecular Weight: | 258.23 | |
| InChI: | InChI=1/C13H10N2O4/c16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19/h1-4,9H,5-6H2,(H,14,16,17) | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2811 | |
| Density: | 1.503 g/cm3 | |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | |
| Refractive index: | 1.646 | |
| Water Solubility: | <0.1 g/100 mL at 22 ºC | |
| Appearance: | white solid | |
| Specification: |
? Thalidomide , with CAS number of 50-35-1, can be called Phthalimide,N-(2,6-dioxo-3-piperidyl)- (6CI,7CI,8CI) ; 1,3-Dioxo-2-(2,6-dioxopiperidin-3-yl)isoindoline ; 3-Phthalimidoglutarimide ; Contergan ; N-(2,6-Dioxo-3-piperidyl)phthalimide ; N-Phthaloylglutamimide ; a-(N-Phthalimido)glutarimide ; a-Phthalimidoglutarimide . It is a?white powder. Thalidomide (CAS NO.50-35-1) is a sedative-hypnotic and multiple myeloma medication found to have an inhibitory effect on morning sickness,insomnia, coughs, colds and headaches, but it may lead to severe birth defects if it is taken during pregnancy. | |
| Report: |
EPA Genetic Toxicology Program. | |
| Packinggroup: | III | |
| Storage Temperature: | Store at RT | |
| Color: | Needles | |
| Safety Data | ||
| Hazard Symbols |
T:Toxic
|
|
 |
||
