| Identification | |
| Name: | L(+)-Ascorbic acid |
| Synonyms: | (+)-Ascorbicacid;100M;3-Oxo-L-gulofuranolactone;3-keto-L-Gulofuranolactone;Ascorbicap;Ascorell;Ascorteal;Ascorvit;C-Quin;Cantan;Catavin C;Ce-Vi-Sol;Cebion;Cecon;Ceglion;Celaskon;Cell C;Cenetone;Cergona;Cescorbat;Cetamid;L-Lyxoascorbic acid;L-Xyloascorbic acid;L-threo-Hex-2-enonic acid, g-lactone;Lemascorb;NSC 218455;Neo-Valdrin;P 1110;Scorbu C;Testascorbic;VC 40;Vitamin C;vitamin C (ascorbic acid);L-Ascorbic acid; |
| CAS: | 50-81-7 |
| EINECS: | 200-066-2 |
| Molecular Formula: | C6H8O6 |
| Molecular Weight: | 176.12 |
| InChI: | InChI=1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.7 |
| Stability: | Stable. May be weakly light or air sensitive. Incompatible with oxidizing agents, alkalies, iron, copper. |
| Refractive index: | 1.711 |
| Alpha: | 20.5 o (C=10,H2O) |
| Appearance: | White to very pale yellow crystalline powder with a pleasant sharp acidic taste |
| Specification: | White crystals Safety Statements:24/25-36-26 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29362700 |
| Color: | white to slightly yellow |
| Safety Data | |
 |
|
