| Identification | |
| Name: | Floxuridine |
| Synonyms: | 1-(2-Deoxy-b-D-ribofuranosyl)-5-fluorouracil;5-Fluoro-2'-deoxy-b-uridine;5-Fluoro-2'-deoxyuridine;5-Fluorodeoxyuridine;5-Fluorouracil 2'-deoxyriboside;5-Fluorouracil deoxyriboside;Floxuridin;NSC 26740;NSC 27640;2'-Deoxy-5-fluorouridine; |
| CAS: | 50-91-9 |
| EINECS: | 200-072-5 |
| Molecular Formula: | C9H11FN2O5 |
| Molecular Weight: | 246.19 |
| InChI: | InChI=1/C9H11FN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h2,5-7,13-14H,1,3H2,(H,11,15,16)/t5-,6+,7+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Boiling Point: | 150 °C |
| Density: | 1.64 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.608 |
| Alpha: | 35.9 o (C=1, WATER) |
| Water Solubility: | soluble |
| Solubility: | 1 g in about 4.5 ml isopropanol, about 7.5 ml methanol, about 12 ml alcohol, about 27 ml acetone; insol in chloroform, ether, and benzene In water, 1.2X10+4 mg/L at 25 deg C (est) |
| Appearance: | white to off-white crystalline powder |
| Specification: | White Solid usageEng:Antiviral; antineoplastic. Safety Statements:22-36-36/37/39-26 22:Do not breathe dust 36:Wear suitable protective clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Report: |
EPA Genetic Toxicology Program. |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Color: | Crystals from butyl acetate WHITE TO OFF-WHITE SOLID |
| Usage: | Antiviral; antineoplastic. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
