| Identification | |
| Name: | 6-Propyl-2-thioxo-2, 3-dihydropyrimidin-4(1H)-one |
| Synonyms: | 2,3-Dihydro-6-propyl-2-thioxo-4(1H)-pyrimidinone;2-Mercapto-4-hydroxy-6-n-propylpyrimidine;2-Mercapto-6-propyl-4-pyrimidone;2-Thio-4-oxo-6-propyl-1,3-pyrimidine;2-Thio-6-propyl-1,3-pyrimidin-4-one;4-Propyl-2-thiouracil;Procasil;Propacil;Propilthiouracil;Prothyran;Thiuragyl;NSC 6498;4(1H)-Pyrimidinone, 2,3-dihydro-6-propyl-2-thioxo-;Uracil, 6-propyl-2-thio-;Prothiurone; |
| CAS: | 500-50-5 |
| EINECS: | 200-103-2 |
| Molecular Formula: | C7H10N2OS |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C7H10N2OS/c1-2-3-5-4-6(10)9-7(11)8-5/h4H,2-3H2,1H3,(H2,8,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 219-221 deg C |
| Flash Point: | 168.6°C |
| Boiling Point: | 355.2°Cat760mmHg |
| Density: | 1.24g/cm3 |
| Solubility: | 1 part dissolves in about 900 parts water at 20 deg C, in 100 parts boiling water, in 60 parts ethyl alc, in 60 parts acetone; practically insol in ether, chloroform, benzene; freely sol in aq soln of ammonia and alkali hydroxides In water, 1204 mg/L at 25 deg C |
| Flash Point: | 168.6°C |
| Color: | White crystalline powder of starch-like appearance to eye and to touch |
| Safety Data | |
 |
|
