| Identification | |
| Name: | Benzeneacetic acid, a-methylene-,(3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester |
| Synonyms: | 1aH,5aH-Tropan-3a-ol, atropate (ester) (8CI); Apoatropine (6CI,7CI); Benzeneacetic acid, a-methylene-,8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, endo-; Apoatropin; Apohyoscyamin;Apohyoscyamine; Atropamin; Atropamine; Atropyltropeine |
| CAS: | 500-55-0 |
| EINECS: | 207-906-7 |
| Molecular Formula: | C17H21 N O2 |
| Molecular Weight: | 271.39 |
| InChI: | InChI=1/C17H21NO2/c1-12(13-6-4-3-5-7-13)17(19)20-16-10-14-8-9-15(11-16)18(14)2/h3-7,14-16H,1,8-11H2,2H3/t14-,15+,16+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1544 |
| Flash Point: | 136.5°C |
| Boiling Point: | 389.1°Cat760mmHg |
| Density: | 1.13g/cm3 |
| Refractive index: | 1.572 |
| Specification: |
Apoatropine (CAS NO.500-55-0) is high toxic. It is flammable. It will produce toxic fumes when buring. So the storage environment should be ventilate, low-temperature and dry. Keep Apoatropine (CAS NO.500-55-0) separate from raw materials of food. |
| Flash Point: | 136.5°C |
| Safety Data | |
 |
|
