| Identification | |
| Name: | Propanoic acid,3-[(aminocarbonyl)amino]-2-fluoro- |
| Synonyms: | b-Alanine, N-carbamoyl-2-fluoro-(6CI,7CI,8CI); 2-Fluoro-3-ureidopropionic acid; N-Carbamoyl-2-fluoro-b-alanine; a-Fluoro-b-ureidopropionic acid |
| CAS: | 5006-64-4 |
| Molecular Formula: | C4H7 F N2 O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C4H7FN2O3/c5-2(3(8)9)1-7-4(6)10/h2H,1H2,(H,8,9)(H3,6,7,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 154.2°C |
| Boiling Point: | 331.3°Cat760mmHg |
| Density: | 1.434g/cm3 |
| Refractive index: | 1.474 |
| Specification: | Off-White to Pale Yellow Solid usageEng:A metabolite of Capecitabine |
| Flash Point: | 154.2°C |
| Usage: | A metabolite of Capecitabine |
| Safety Data | |
 |
|
