| Identification | |
| Name: | 6-Hydroxynicotinic acid |
| Synonyms: | 2-Hydroxypyridine-5-carboxylic acid; 6-oxonicotinic acid |
| CAS: | 5006-66-6 |
| EINECS: | 225-682-9 |
| Molecular Formula: | C6H5NO3 |
| Molecular Weight: | 139.11 |
| InChI: | InChI=1/C6H5NO3/c8-5-2-1-4(3-7-5)6(9)10/h1-3H,(H,7,8)(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.451 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | Off-white powder |
| Specification: |
?6-Hydroxynicotinic acid , with CAS number of 5006-66-6, can be called 1,6-dihydro-6-oxo-3-pyridinecarboxylicaci ; 2-Hydroxy-5-pyridinecarboxylic acid ; 2-hydroxypyridine-5-carboxylic acid ; 5-carboxy-2(1h)-pyridinone ; 6-hydroxy-3-pyridinecarboxylic acid ; 6-hydroxynicotinic acid . It is an?off-white powder,?6-Hydroxynicotinic acid (CAS NO.5006-66-6) is used as building block in chemical synthesis. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | 6-Hydroxynicotinic acid is used as building block in chemical synthesis. Product Data Sheet |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
