| Identification |
| Name: | Hydrazinecarboximidamide,2-[(2,6-dichlorophenyl)methylene]- |
| Synonyms: | Guanidine,[(2,6-dichlorobenzylidene)amino]- (7CI,8CI); Guanabenz;N-(2,6-Dichlorobenzylidene)-N'-amidinohydrazine; NSC 68982; Wy 8678;[(2,6-Dichlorobenzylidene)amino]guanidine |
| CAS: | 5051-62-7 |
| EINECS: | 225-750-8 |
| Molecular Formula: | C8H8 Cl2 N4 |
| Molecular Weight: |
231.08 |
| InChI: | InChI=1/C8H8Cl2N4/c9-6-2-1-3-7(10)5(6)4-13-14-8(11)12/h1-4H,(H4,11,12,14)/b13-4+ |
| Molecular Structure: |
![(C8H8Cl2N4) Guanidine,[(2,6-dichlorobenzylidene)amino]- (7CI,8CI); Guanabenz;N-(2,6-Dichlorobenzylidene)-N'-amid...](https://img1.guidechem.com/chem/e/dict/130/5051-62-7.jpg) |
| Properties |
| Transport: | 3249 |
| Melting Point: | 227-229 deg C (decomposition) |
| Flash Point: | 199.1°C |
| Boiling Point: | 405.7°Cat760mmHg |
| Density: | 1.49g/cm3 |
| Refractive index: | 1.645 |
| Solubility: | Solubility of 50 mg/ml in alcohol at 25 deg C In water, 11 mg/ml @ 25 deg C |
| Specification: | Safety Statements:22-36/37/39 22:Do not breathe dust 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
| Packinggroup: | III |
| Flash Point: | 199.1°C |
| Color: | White solid from acetonitrile White to almost white powder |
| Safety Data |
| |
 |