| Identification | |
| Name: | Acetamide,2-chloro-N-(2,6-dimethylphenyl)-N-(2-methoxyethyl)- |
| Synonyms: | A 4766; A5089; CGA 17020; Dimethachlor; N-(2-Methoxyethyl)-2,6-dimethyl-a-chloroacetanilide; N-(2-Methoxyethyl)-2,6-dimethylchloroacetanilide;N-Methoxyethyl-N-chloroacetyl-2,6-dimethylaniline; Teridox |
| CAS: | 50563-36-5 |
| EINECS: | 251-899-3 |
| Molecular Formula: | C13H18 Cl N O2 |
| Molecular Weight: | 255.77 |
| InChI: | InChI=1/C13H18ClNO2/c1-10-5-4-6-11(2)13(10)15(7-8-17-3)12(16)9-14/h4-6H,7-9H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3077 9/PG 3 |
| Flash Point: | 180°C |
| Boiling Point: | 374°C at 760 mmHg |
| Density: | 1.139g/cm3 |
| Refractive index: | 1.543 |
| Specification: | Safety Statements:24-37-60-61 24:Avoid contact with skin 37:Wear suitable gloves 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 180°C |
| Storage Temperature: | 0-6°C |
| Safety Data | |
 |
|
