| Identification | |
| Name: | heptadecanoic acid |
| Synonyms: | Margaricacid; Margarinic acid; NSC 3743; n-Heptadecanoic acid; n-Heptadecoic acid;n-Heptadecylic acid |
| CAS: | 506-12-7 |
| EINECS: | 208-027-1 |
| Molecular Formula: | C17H34O2 |
| Molecular Weight: | 270.4507 |
| InChI: | InChI=1S/C17H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h2-16H2,1H3,(H,18,19) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 59-61 C |
| Flash Point: | 158.4°C |
| Boiling Point: | 298.5°Cat760mmHg |
| Density: | 0.89g/cm3 |
| Stability: | Stable. Incompatible with bases, oxidizing agents, reducing agents. |
| Refractive index: | 1.454 |
| Appearance: | off-white powder |
| Specification: |
Heptadecanoic acid with CAS number of 506-12-7 is also known as 4-02-00-01193 (Beilstein Handbook Reference) ; AI3-36481 ; BRN 1781004 ; EINECS 208-027-1 ; Margaric acid ; Margarinic acid ; NSC 3743 ; n-Heptadecanoic acid ; n-Heptadecoic acid ; n-Heptadecylic acid . As in any fire, wear a self-contained breathing apparatus in pressure-demand, MSHA/NIOSH (approved or equivalent), and full protective gear. Use water spray, dry chemical, carbon dioxide, or chemical foam. Avoid breathing dust, vapor, mist, or gas. Avoid contact with skin and eyes. Avoid ingestion and inhalation. Store in a cool, dry place. Store in a tightly closed container. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 158.4°C |
| Safety Data | |
 |
|
