| Identification | |
| Name: | Glycine,N,N-bis(carboxymethyl)-, sodium salt (1:3) |
| Synonyms: | Aceticacid, nitrilotri-, trisodium salt (8CI);Glycine, N,N-bis(carboxymethyl)-,trisodium salt (9CI);A 92R;Chelest 70;Chelest 700;Chemcolox 365 Powder;Clewat C 3;Dissolvine A 40;Dissolvine A 92;Hampshire NTA 150;Masquol NP140;NTA sodium salt;NTA trisodium salt;Syntron A;Trilon A;Trilon A 50;Trilon A 92;Trilon A 92R;Trisodium2,2',2''-nitrilotriacetate;Trisodium NTA;VerseneNTA 148;Versene NTA 150;Versene NTA 335; |
| CAS: | 5064-31-3 |
| EINECS: | 225-768-6 |
| Molecular Formula: | C6H6NNa3O6 |
| Molecular Weight: | 257.08425 |
| InChI: | InChI=1S/C6H9NO6.3Na/c8-4(9)1-7(2-5(10)11)3-6(12)13;;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;;/q;3*+1/p-3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 260kgs |
| Melting Point: | Decomposes |
| Flash Point: | 255.1°C |
| Boiling Point: | 498.2°Cat760mmHg |
| Density: | g/cm3 |
| Stability: | No data. |
| Water Solubility: | Miscible AUTOIGNITION |
| Solubility: | Miscible
AUTOIGNITION
Appearance:Clear,
straw-colored liquid Transport Information:260kgs Hazard Symbols:UN NO. particular:particular |
| Appearance: | Clear, straw-colored liquid |
| Specification: | usageEng:An excellent chelating agent. Safety Statements:36 36:Wear suitable protective clothing |
| Flash Point: | 255.1°C |
| Storage Temperature: | Keep containers tightly sealed. Store in a cool dry area. Take precautionary measures against static discharges. Ensure all storage areas are well ventilated. |
| Usage: | Chelating and sequestering agent; builder in synthetic detergents and cleaners. |
| Safety Data | |
| Hazard Symbols | |
 |
|
