| Identification | |
| Name: | 2,2-Dimethyl-3-thiomorpholinone |
| Synonyms: | 2,2-Dimethylthiomorpholin-3-one;3-thiomorpholinone, 2,2-dimethyl- |
| CAS: | 50847-92-2 |
| Molecular Formula: | C6H11NOS |
| Molecular Weight: | 145.2226 |
| InChI: | InChI=1/C6H11NOS/c1-6(2)5(8)7-3-4-9-6/h3-4H2,1-2H3,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 141.5°C |
| Boiling Point: | 310.3°C at 760 mmHg |
| Density: | 1.06g/cm3 |
| Refractive index: | 1.487 |
| Specification: |
A regime or regimen for preventing and/or treating an inflammatory skin pathology/affliction, comprising administering to a subject in need of such treatment, a thus effective amount of at least one compound selected from the group consisting of the compounds of formula (I): STR00004 in which R is a --CH.sub.3 radical or a CH.sub.2OH radical, or a pharmaceutically acceptable salt, solvate or hydrate thereof, formulated into a physiologically/pharmaceutically acceptable carrier/excipient therefor. |
| Flash Point: | 141.5°C |
| Safety Data | |
 |
|
