| Identification |
| Name: | 2-Propenoic acid, isooctyl ester, polymer with 2-propenamide |
| Synonyms: | 2-Propenoic acid, isooctyl ester, polymer with 2-propenamide;2-Propenoic acid, isooctyl ester, polymer with 2-propenamide 2-Propenamide, isooctyl 2-propenoate polymer,isoctyl acrylate,acrylamide polymer |
| CAS: | 50922-82-2 |
| Molecular Formula: | C14H25NO3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C11H20O2.C3H5NO/c1-4-11(12)13-9-7-5-6-8-10(2)3;1-2-3(4)5/h4,10H,1,5-9H2,2-3H3;2H,1H2,(H2,4,5) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 74.7°C |
| Boiling Point: | 227.7°C at 760 mmHg |
| Flash Point: | 74.7°C |
| Safety Data |
| |
 |
