| Identification | |
| Name: | Benzimidazole |
| Synonyms: | Benzimidazole(6CI,8CI);1,3-Benzodiazole;1,3-Diazaindene;3-Azaindole;Azindole;BZI;N,N'-Methenyl-o-phenylenediamine;NSC 759;1H-Benzimidazole; |
| CAS: | 51-17-2 |
| EINECS: | 200-081-4 |
| Molecular Formula: | C7H6N2 |
| Molecular Weight: | 118.14 |
| InChI: | InChI=1/C7H6N2/c1-2-4-7-6(3-1)8-5-9-7/h1-5H,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 208.4 oC |
| Density: | 1.242 g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidising agents. |
| Water Solubility: | sparingly soluble |
| Solubility: | Sparingly soluble in water |
| Appearance: | White crystal |
| HS Code: | 29339990 |
| Flash Point: | 208.4 oC |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Color: | RHOMBIC, BIPYRAMIDAL PLATES IN WATER Tabular crystals Othrorombic and monoclinic modifications |
| Usage: | A group of systemic fungicides benzimidazoles. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
