| Identification | |
| Name: | norepinephrine |
| Synonyms: | Arterenol; Levophed; NA; NE; noradrenalin |
| CAS: | 51-41-2 |
| EINECS: | 200-096-6 |
| Molecular Formula: | C8H11NO3 |
| Molecular Weight: | 169.18 |
| InChI: | InChI=1/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2/t8-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.397 g/cm3 |
| Stability: | Stable, but may be light-sensitive. Incompatible with acids, bases, oxidizing agents. Store at -20C. |
| Refractive index: | 1.66 |
| Solubility: |
|
| Appearance: | crystalline |
| Packinggroup: | II |
| Sensitive: | Air & Light Sensitive |
| Color: | off-white to tan |
| Usage: | Adrenergic hormone. |
| Safety Data | |
| Hazard Symbols |
T+:Verytoxic
|
 |
|
