| Identification | |
| Name: | 4-Hydroxy-2-mercapto-6-propylpyrimidine |
| Synonyms: | Propylthiouracil; 6-n-Propyl-2-thiouracil; 6-PROPYL-2-THIOURACYLE; 6-Propyl-2-thiouracil; Propylthiouracil |
| CAS: | 51-52-5 |
| EINECS: | 200-103-2 |
| Molecular Formula: | C7H10N2OS |
| Molecular Weight: | 170.23 |
| InChI: | InChI=1/C7H10N2OS/c1-2-3-5-4-6(10)9-7(11)8-5/h4H,2-3H2,1H3,(H2,8,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 20kgs |
| Flash Point: | 326 C |
| Density: | 1.24g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong acids, strong bases. Light sensitive. |
| Refractive index: | 1.609 |
| Water Solubility: | 1.1 g/L |
| Solubility: | Slightly soluble |
| Appearance: | white to off-white crystalline powder |
| HS Code: | 29335995 |
| Flash Point: | 326 C |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. Hormones and antibiotics room. |
| Color: | White crystalline powder of starch-like appearance to eye and to touch |
| Usage: | Antihyperthyroid. Has been used to promote fattening. This substance is reasonably anticipated to be a human carcinogen |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
