| Identification | |
| Name: | 1,2-Benzenediol,4-(2-aminoethyl)- |
| Synonyms: | Pyrocatechol,4-(2-aminoethyl)- (8CI);2-(3,4-Dihydroxyphenyl)-1-ethanamine;2-(3,4-Dihydroxyphenyl)ethylamine;3,4-Dihydroxyphenylethylamine;3-Hydroxytyramine;4-(2-Aminoethyl)-1,2-benzenediol;4-(2-Aminoethyl)catechol;Hydroxytyramin;NSC 173182;Oxytyramine; |
| CAS: | 51-61-6 |
| EINECS: | 200-110-0 |
| Molecular Formula: | C8H11NO2 |
| Molecular Weight: | 153.20 |
| InChI: | InChI=1/C8H11NO2.ClH/c9-4-3-6-1-2-7(10)8(11)5-6;/h1-2,5,10-11H,3-4,9H2;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 218-220 oC |
| Density: | 1.247g/cm3 |
| Solubility: | Freely soluble in water, methanol, and hot 95% ethanol but is practically insoluble in ether, petroleum ether, chloroform, benzene, and toluene. In water, 1X10+6 mg/L at 25 deg C (miscible) (est) |
| Color: | Stout prisms |
| Safety Data | |
 |
|
