| Identification | |
| Name: | DL-4-Fluorophenylalanine |
| Synonyms: | 4-Fluoro-DL-phenylalanine; H-DL-Phe(4-F)-OH |
| CAS: | 51-65-0 |
| EINECS: | 200-113-7 |
| Molecular Formula: | C9H10FNO2 |
| Molecular Weight: | 183.18 |
| InChI: | InChI=1/C9H10FNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Flash Point: | 143.3°C |
| Boiling Point: | 313.3°Cat760mmHg |
| Density: | 1.293g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidising agents. May be light sensitive. |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | White powder or white shiny flakes. |
| Report: |
EPA Genetic Toxicology Program. |
| Packinggroup: | III |
| Flash Point: | 143.3°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
