| Identification | |
| Name: | Benzeneacetic acid, a-methyl-4-(2-methylpropyl)-, (aR)- |
| Synonyms: | Benzeneaceticacid, a-methyl-4-(2-methylpropyl)-,(R)-; (-)-Ibuprofen; (-)-Ibuprophen; (-)-a-Methyl-4-(2-methylpropyl)benzeneacetic acid;(R)-(-)-Ibuprofen; (R)-2-(4-Isobutylphenyl)propanoic acid; (R)-Ibuprofen; (aR)-a-Methyl-4-(2-methylpropyl)benzeneacetic acid;R-(-)-p-Isobutylhydratropic acid; l-Ibuprofen |
| CAS: | 51146-57-7 |
| Molecular Formula: | C13H18 O2 |
| Molecular Weight: | 206.28 |
| InChI: | InChI=1/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/t10-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 216.7°C |
| Boiling Point: | 319.6°Cat760mmHg |
| Density: | 1.029g/cm3 |
| Refractive index: | 1.518 |
| Specification: | White Crystalline Solid usageEng:A nonsteroidal anti-inflammatory drug (NSAID); activity resides primarily in the (S)-isomer |
| Flash Point: | 216.7°C |
| Storage Temperature: | Refrigerator |
| Usage: | A nonsteroidal anti-inflammatory drug (NSAID); activity resides primarily in the (S)-isomer |
| Safety Data | |
 |
|
