| Identification | |
| Name: | Hexazinone |
| Synonyms: | 3-Cyclohexyl-6-(dimethylamino)-1-methyl-s-triazine-2,4(1H,3H)-dione;DPX 3674; Hexazinone; Pronone; Pronone 10G; Velpar; Velpar L |
| CAS: | 51235-04-2 |
| EINECS: | 257-074-4 |
| Molecular Formula: | C12H20 N4 O2 |
| Molecular Weight: | 252.3128 |
| InChI: | InChI=1S/C12H20N4O2/c1-14(2)10-13-11(17)16(12(18)15(10)3)9-7-5-4-6-8-9/h9H,4-8H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3077 9/PG 3 |
| Melting Point: | 97-100.5 |
| Density: | 1.27g/cm3 |
| Stability: | Stable at normal temperatures and storage conditions. |
| Refractive index: | 1.513 (25 C) |
| Solubility: | 33 g/kg @ 25 C |
| Appearance: | Tan, free flowing granules with a slight acrid odor. |
| Color: | White crystalline solid Colorless crystals |
| Usage: | Control of many annual, biennial and perennial weeds and woody plants on noncropland areas. Selective weed control in conifers, sugarcane, pineapple, rubber trees and alfalfa. |
| Safety Data | |
 |
|
