| Identification | |
| Name: | Benzoic acid,5-chloro-2-nitro-, methyl ester |
| Synonyms: | 4-Chloro-2-methoxycarbonylnitrobenzene;5-Chloro-2-nitrobenzoic acid methyl ester; |
| CAS: | 51282-49-6 |
| EINECS: | 257-107-2 |
| Molecular Formula: | C8H6ClNO4 |
| Molecular Weight: | 215.59 |
| InChI: | InChI=1/C8H6ClNO4/c1-14-8(11)6-4-5(9)2-3-7(6)10(12)13/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 139°C |
| Boiling Point: | 306.2°Cat760mmHg |
| Density: | 1.426g/cm3 |
| Stability: | Decomposition will not occur if used and stored according to specifications. |
| Refractive index: | 1.568 |
| Solubility: | Insoluble |
| Appearance: | Powder. |
| Specification: | white to light yellow crystalline powder or chunks Safety Statements:36-37/39-26 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 139°C |
| Storage Temperature: | Keep container tightly sealed. Store in cool, dry conditions in well sealed containers. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
