| Identification | |
| Name: | 2-butanethiol |
| Synonyms: | 1-methyl-1-propanethiol; Butylmercaptan; 93%; sec-Butyl mercaptan |
| CAS: | 513-53-1 |
| EINECS: | 208-165-2 |
| Molecular Formula: | C4H10S |
| Molecular Weight: | 90.19 |
| InChI: | InChI=1/C4H10S/c1-3-4(2)5/h4-5H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2347 |
| Melting Point: | -140 C |
| Flash Point: | 70? |
| Density: | 0.83 |
| Stability: | No data. |
| Refractive index: | 1.436 |
| Water Solubility: | Slightly soluble |
| Solubility: | Slightly soluble |
| Appearance: | clear liquid |
| Packinggroup: | II |
| HS Code: | 29309070 |
| Flash Point: | 70? |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Colorles liquid Mobile liquid |
| Usage: | Odorant for natural gas. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xi:Irritant
|
 |
|
