| Identification | ||
| Name: | 1,10-Phenanthroline monohydrate | |
| Synonyms: | 1,10-Phenanthroline hydrate | |
| CAS: | 5144-89-8 | |
| EINECS: | 200-629-2 | |
| Molecular Formula: | C12H8N2?H2O | |
| Molecular Weight: | 198.22 | |
| InChI: | InChI=1/C12H8N2.H2O/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-8H;1H2 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2811 | |
| Density: | 1.1 | |
| Stability: | Stable. Incompatible with iron, other heavy metals, strong oxidizing agents, strong acids. | |
| Water Solubility: | <0.01 g/100 mL at 21 ºC | |
| Appearance: | white crystals or powder | |
| Specification: |
?1,10-Phenanthroline hydrate , its CAS NO. is 5144-89-8, the synonyms are? 4,5-Phenanthroline monohydrate ;? AI3-22011 ; o-Phenanthroline monohydrate . | |
| Packinggroup: | III | |
| HS Code: | 29339990 | |
| Storage Temperature: | Store at RT. | |
| Usage: | Used as a bidentate ligand in coordination chemistry. | |
| Safety Data | ||
| Hazard Symbols |
T:Toxic
|
|
 |
||
