| Identification | |
| Name: | Propanoicacid, 2-hydroxy-, ammonium salt (1:1) |
| Synonyms: | Ammoniumlactate (6CI,7CI);Lactic acid, monoammonium salt (8CI);Propanoic acid,2-hydroxy-, monoammonium salt (9CI);Ammonium 2-hydroxypropionate;BMS186091;Lac-Hydrin;W 1001-10; |
| CAS: | 515-98-0 |
| EINECS: | 208-214-8 |
| Molecular Formula: | C3H6O3.H3N |
| Molecular Weight: | 107.11 |
| InChI: | InChI=1/C3H6O3.H3N/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 91-94 |
| Flash Point: | 109.9°C |
| Boiling Point: | 227.6°Cat760mmHg |
| Density: | g/cm3 |
| Stability: | No data. |
| Refractive index: | n20/D 1.363 |
| Solubility: | 225 g/100 ml water |
| Appearance: | White solid or liquid. Has no odor. |
| Specification: |
Propanoicacid, 2-hydroxy-, ammonium salt (1:1) , its cas register number is 515-98-0. It also can be called Lac-Hydrin ; Amlactin ; Ammonium (+-)-lactate ; Ammonium lactate ; Propanoic acid, 2-hydroxy-, monoammonium salt, (+-)- ; Propanoic acid, 2-hydroxy-, monoammonium salt .It is a white solid or liquid and it has no odor. |
| Flash Point: | 109.9°C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data | |
 |
|
