| Identification |
| Name: | 1(2H)-Isoquinolinone,5-hydroxy- |
| Synonyms: | 1,5-Isoquinolinediol(7CI,8CI);1,5-Dihydroxyisoquinoline;NSC 65585; |
| CAS: | 5154-02-9 |
| Molecular Formula: | C9H7NO2 |
| Molecular Weight: | 161.1574 |
| InChI: | InChI=1/C9H7NO2/c11-8-3-1-2-7-6(8)4-5-10-9(7)12/h1-5,11H,(H,10,12) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.337 g/cm1.337 g/cm3 |
| Refractive index: | 1.639 |
| Water Solubility: | DMSO: >36 mg/mL |
| Solubility: | DMSO: >36 mg/mL |
| Appearance: | Of white to white powder |
| Storage Temperature: | 2-8°C |
| Color: | off-white |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
